C17H15ClF3N7O4S — CID 169241875
[3-chloro-5-[[methyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]amino]carbamoyl]phenyl] trifluoromethanesulfonate (PubChem CID 169241875) has the molecular formula C17H15ClF3N7O4S and a molecular weight of 505.87 g/mol. Its IUPAC name is [3-chloro-5-[[methyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]amino]carbamoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-chloro-5-[[methyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]amino]carbamoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169241875 |
| Molecular Formula | C17H15ClF3N7O4S |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | [3-chloro-5-[[methyl-[1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]amino]carbamoyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(c1ncnn1-c1ncccn1)N(C)NC(=O)c1cc(Cl)cc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3N7O4S/c1-10(14-24-9-25-28(14)16-22-4-3-5-23-16)27(2)26-15(29)11-6-12(18)8-13(7-11)32-33(30,31)17(19,20)21/h3-10H,1-2H3,(H,26,29) |
| InChIKey | MQTDWONKFMQULI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|