C18H15Cl2F4N7O2 — CID 171409592
3-[2,4-dichloro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-methyl-1-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea (PubChem CID 171409592) has the molecular formula C18H15Cl2F4N7O2 and a molecular weight of 508.26 g/mol. Its IUPAC name is 3-[2,4-dichloro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-methyl-1-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea.
| Compound Name | 3-[2,4-dichloro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-methyl-1-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 171409592 |
| Molecular Formula | C18H15Cl2F4N7O2 |
| Molecular Weight | 508.26 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 3-[2,4-dichloro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-methyl-1-[(1S)-1-(2-pyrimidin-2-yl-1,2,4-triazol-3-yl)ethyl]urea |
| SMILES | C[C@@H](c1ncnn1-c1ncccn1)N(C)C(=O)Nc1cc(OC(F)(F)C(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2F4N7O2/c1-9(14-27-8-28-31(14)16-25-4-3-5-26-16)30(2)17(32)29-12-7-13(11(20)6-10(12)19)33-18(23,24)15(21)22/h3-9,15H,1-2H3,(H,29,32)/t9-/m0/s1 |
| InChIKey | KBQIFVLYRLYYEP-VIFPVBQESA-N |
| XLogP | 4.83 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|