C19H31NO2 — CID 156705531
tert-butyl 2-[(1R,5S,6S)-6-(aminomethyl)-3-(cyclobutylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 156705531) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is tert-butyl 2-[(1R,5S,6S)-6-(aminomethyl)-3-(cyclobutylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[(1R,5S,6S)-6-(aminomethyl)-3-(cyclobutylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 156705531 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | tert-butyl 2-[(1R,5S,6S)-6-(aminomethyl)-3-(cyclobutylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@]1(CN)C[C@H]2CC(CC3CCC3)=C[C@H]21 |
| InChI | InChI=1S/C19H31NO2/c1-18(2,3)22-17(21)11-19(12-20)10-15-8-14(9-16(15)19)7-13-5-4-6-13/h9,13,15-16H,4-8,10-12,20H2,1-3H3/t15-,16-,19-/m1/s1 |
| InChIKey | QCXDFZGXPDZVSM-GPMSIDNRSA-N |
| XLogP | 3.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|