C25H23N3O5 — CID 15670869
tert-butyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-quinolin-8-ylamino]acetate (PubChem CID 15670869) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is tert-butyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-quinolin-8-ylamino]acetate.
| Compound Name | tert-butyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-quinolin-8-ylamino]acetate |
|---|---|
| PubChem CID | 15670869 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | tert-butyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]-quinolin-8-ylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(C(=O)CN1C(=O)c2ccccc2C1=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C25H23N3O5/c1-25(2,3)33-21(30)15-27(19-12-6-8-16-9-7-13-26-22(16)19)20(29)14-28-23(31)17-10-4-5-11-18(17)24(28)32/h4-13H,14-15H2,1-3H3 |
| InChIKey | BQOPLZBBUXKALD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|