C14H28N2 — CID 156708878
2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[3,4-b]pyridine;4,4-dimethylpent-1-ene (PubChem CID 156708878) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[3,4-b]pyridine;4,4-dimethylpent-1-ene.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[3,4-b]pyridine;4,4-dimethylpent-1-ene |
|---|---|
| PubChem CID | 156708878 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydro-1H-pyrrolo[3,4-b]pyridine;4,4-dimethylpent-1-ene |
| SMILES | C1CNC2CNCC2C1.C=CCC(C)(C)C |
| InChI | InChI=1S/C7H14N2.C7H14/c1-2-6-4-8-5-7(6)9-3-1;1-5-6-7(2,3)4/h6-9H,1-5H2;5H,1,6H2,2-4H3 |
| InChIKey | KXFIIMZXBYKZTN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|