C12H19N7 — CID 156710850
N,N-dimethylethanamine;N'-(1,2,4-triazol-4-yl)pyridine-4-carboximidamide (PubChem CID 156710850) has the molecular formula C12H19N7 and a molecular weight of 261.33 g/mol. Its IUPAC name is N,N-dimethylethanamine;N'-(1,2,4-triazol-4-yl)pyridine-4-carboximidamide.
| Compound Name | N,N-dimethylethanamine;N'-(1,2,4-triazol-4-yl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 156710850 |
| Molecular Formula | C12H19N7 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N,N-dimethylethanamine;N'-(1,2,4-triazol-4-yl)pyridine-4-carboximidamide |
| SMILES | CCN(C)C.N/C(=N\n1cnnc1)c1ccncc1 |
| InChI | InChI=1S/C8H8N6.C4H11N/c9-8(7-1-3-10-4-2-7)13-14-5-11-12-6-14;1-4-5(2)3/h1-6H,(H2,9,13);4H2,1-3H3 |
| InChIKey | DRLIHDUJUWXURB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|