C9H9N5 — CID 6271059
(Z)-1-pyridin-4-yl-N-(1,2,4-triazol-4-yl)ethanimine (PubChem CID 6271059) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is (Z)-1-pyridin-4-yl-N-(1,2,4-triazol-4-yl)ethanimine.
| Compound Name | (Z)-1-pyridin-4-yl-N-(1,2,4-triazol-4-yl)ethanimine |
|---|---|
| PubChem CID | 6271059 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | (Z)-1-pyridin-4-yl-N-(1,2,4-triazol-4-yl)ethanimine |
| SMILES | C/C(=N/n1cnnc1)c1ccncc1 |
| InChI | InChI=1S/C9H9N5/c1-8(9-2-4-10-5-3-9)13-14-6-11-12-7-14/h2-7H,1H3/b13-8- |
| InChIKey | JNTXFFNVCVVWMD-JYRVWZFOSA-N |
| XLogP | 0.95 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|