C30H24N2O4S2 — CID 156713217
pyridin-2-ylmethyl 4-[5-[(3E)-3-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)propyl]furan-2-yl]benzoate (PubChem CID 156713217) has the molecular formula C30H24N2O4S2 and a molecular weight of 540.67 g/mol. Its IUPAC name is pyridin-2-ylmethyl 4-[5-[(3E)-3-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)propyl]furan-2-yl]benzoate.
| Compound Name | pyridin-2-ylmethyl 4-[5-[(3E)-3-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)propyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 156713217 |
| Molecular Formula | C30H24N2O4S2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | pyridin-2-ylmethyl 4-[5-[(3E)-3-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)propyl]furan-2-yl]benzoate |
| SMILES | O=C(OCc1ccccn1)c1ccc(-c2ccc(CC/C=C3/SC(=S)N(Cc4ccccc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C30H24N2O4S2/c33-28-27(38-30(37)32(28)19-21-7-2-1-3-8-21)11-6-10-25-16-17-26(36-25)22-12-14-23(15-13-22)29(34)35-20-24-9-4-5-18-31-24/h1-5,7-9,11-18H,6,10,19-20H2/b27-11+ |
| InChIKey | HHIGZVDYDVCSKZ-LUOAPIJWSA-N |
| XLogP | 6.58 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|