C16H17Cl2N3O9S — CID 15671353
2-chloroethyl [1-(chlorosulfonylcarbamoyl)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate (PubChem CID 15671353) has the molecular formula C16H17Cl2N3O9S and a molecular weight of 498.30 g/mol. Its IUPAC name is 2-chloroethyl [1-(chlorosulfonylcarbamoyl)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate.
| Compound Name | 2-chloroethyl [1-(chlorosulfonylcarbamoyl)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 15671353 |
| Molecular Formula | C16H17Cl2N3O9S |
| Molecular Weight | 498.30 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | 2-chloroethyl [1-(chlorosulfonylcarbamoyl)-4-oxo-3-(phenylmethoxycarbonylamino)azetidin-2-yl]methyl carbonate |
| SMILES | O=C(NC1C(=O)N(C(=O)NS(=O)(=O)Cl)C1COC(=O)OCCCl)OCc1ccccc1 |
| InChI | InChI=1S/C16H17Cl2N3O9S/c17-6-7-28-16(25)30-9-11-12(13(22)21(11)14(23)20-31(18,26)27)19-15(24)29-8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,19,24)(H,20,23) |
| InChIKey | BSJZOMASGMHGBG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|