C24H22F2N4O — CID 156714581
1-[4-[4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]pent-4-enyl]indazole-5-carbonitrile (PubChem CID 156714581) has the molecular formula C24H22F2N4O and a molecular weight of 420.46 g/mol. Its IUPAC name is 1-[4-[4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]pent-4-enyl]indazole-5-carbonitrile.
| Compound Name | 1-[4-[4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]pent-4-enyl]indazole-5-carbonitrile |
|---|---|
| PubChem CID | 156714581 |
| Molecular Formula | C24H22F2N4O |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[4-[4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]pent-4-enyl]indazole-5-carbonitrile |
| SMILES | C=C(CCCn1ncc2cc(C#N)ccc21)C(=O)N1CC(F)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C24H22F2N4O/c1-16(4-3-9-30-22-8-7-17(13-27)10-19(22)14-28-30)24(31)29-15-21(26)12-23(29)18-5-2-6-20(25)11-18/h2,5-8,10-11,14,21,23H,1,3-4,9,12,15H2 |
| InChIKey | GSFXFQZTSVFPCP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|