C23H22F2N4O2 — CID 156714794
1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-5-(6-methoxyindazol-1-yl)-2-methylidenepentan-1-one (PubChem CID 156714794) has the molecular formula C23H22F2N4O2 and a molecular weight of 424.45 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-5-(6-methoxyindazol-1-yl)-2-methylidenepentan-1-one.
| Compound Name | 1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-5-(6-methoxyindazol-1-yl)-2-methylidenepentan-1-one |
|---|---|
| PubChem CID | 156714794 |
| Molecular Formula | C23H22F2N4O2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)-3,4-dihydropyrazol-2-yl]-5-(6-methoxyindazol-1-yl)-2-methylidenepentan-1-one |
| SMILES | C=C(CCCn1ncc2ccc(OC)cc21)C(=O)N1N=CCC1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H22F2N4O2/c1-15(4-3-9-28-22-13-20(31-2)6-5-16(22)14-27-28)23(30)29-21(7-8-26-29)17-10-18(24)12-19(25)11-17/h5-6,8,10-14,21H,1,3-4,7,9H2,2H3 |
| InChIKey | PZHJXHKGSNXXCZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|