About 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane
5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane (PubChem CID 156714616) has the molecular formula C14H19ClO3
and a molecular weight of 270.76 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane |
| PubChem CID | 156714616 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane |
| SMILES | C=C(C=O)CCC(O)c1cccc(Cl)c1.COC |
| InChI | InChI=1S/C12H13ClO2.C2H6O/c1-9(8-14)5-6-12(15)10-3-2-4-11(13)7-10;1-3-2/h2-4,7-8,12,15H,1,5-6H2;1-2H3 |
| InChIKey | YBOSTSDDLSWMQY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane?
The IUPAC name of 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane (CID 156714616) is 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane.
What is the SMILES notation for 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane?
The canonical SMILES for 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane is C=C(C=O)CCC(O)c1cccc(Cl)c1.COC.
What is the InChIKey of 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane?
The InChIKey is YBOSTSDDLSWMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO2.C2H6O/c1-9(8-14)5-6-12(15)10-3-2-4-11(13)7-10;1-3-2/h2-4,7-8,12,15H,1,5-6H2;1-2H3.
What are the key properties of 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane?
5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane has a molecular weight of 270.76 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)-5-hydroxy-2-methylidenepentanal;methoxymethane is sourced from PubChem (CID 156714616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).