C17H36N4O — CID 156719712
N,N-dimethylformamide;1-[2-(1-ethylpiperidin-4-yl)ethyl]-4-methylpiperazine (PubChem CID 156719712) has the molecular formula C17H36N4O and a molecular weight of 312.50 g/mol. Its IUPAC name is N,N-dimethylformamide;1-[2-(1-ethylpiperidin-4-yl)ethyl]-4-methylpiperazine.
| Compound Name | N,N-dimethylformamide;1-[2-(1-ethylpiperidin-4-yl)ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 156719712 |
| Molecular Formula | C17H36N4O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | N,N-dimethylformamide;1-[2-(1-ethylpiperidin-4-yl)ethyl]-4-methylpiperazine |
| SMILES | CCN1CCC(CCN2CCN(C)CC2)CC1.CN(C)C=O |
| InChI | InChI=1S/C14H29N3.C3H7NO/c1-3-16-7-4-14(5-8-16)6-9-17-12-10-15(2)11-13-17;1-4(2)3-5/h14H,3-13H2,1-2H3;3H,1-2H3 |
| InChIKey | YYZVKYFQHKKCGX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|