C10H9F4NO2 — CID 156722435
3-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide (PubChem CID 156722435) has the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. Its IUPAC name is 3-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide.
| Compound Name | 3-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 156722435 |
| Molecular Formula | C10H9F4NO2 |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
| SMILES | CC(Oc1c(F)cccc1C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F4NO2/c1-5(10(12,13)14)17-8-6(9(15)16)3-2-4-7(8)11/h2-5H,1H3,(H2,15,16) |
| InChIKey | LJUDUDAWJWSISK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |