C11H11F4NO2 — CID 156722490
3-fluoro-N-methyl-2-(1,1,1-trifluoropropan-2-yloxy)benzamide (PubChem CID 156722490) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is 3-fluoro-N-methyl-2-(1,1,1-trifluoropropan-2-yloxy)benzamide.
| Compound Name | 3-fluoro-N-methyl-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 156722490 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-fluoro-N-methyl-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
| SMILES | CNC(=O)c1cccc(F)c1OC(C)C(F)(F)F |
| InChI | InChI=1S/C11H11F4NO2/c1-6(11(13,14)15)18-9-7(10(17)16-2)4-3-5-8(9)12/h3-6H,1-2H3,(H,16,17) |
| InChIKey | BQXHRZVKYRRDTC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |