About S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol
S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol (PubChem CID 156723253) has the molecular formula C16H25Cl2FN2OS
and a molecular weight of 383.36 g/mol. Its IUPAC name is S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol.
Molecular Properties
| Compound Name | S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol |
| PubChem CID | 156723253 |
| Molecular Formula | C16H25Cl2FN2OS |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol |
| SMILES | CC(C)(C)SN.Oc1cc(Cl)c(Cl)c(F)c1CC1CCNCC1 |
| InChI | InChI=1S/C12H14Cl2FNO.C4H11NS/c13-9-6-10(17)8(12(15)11(9)14)5-7-1-3-16-4-2-7;1-4(2,3)6-5/h6-7,16-17H,1-5H2;5H2,1-3H3 |
| InChIKey | VPEMFFOKGKYYKB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol?
The IUPAC name of S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol (CID 156723253) is S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol.
What is the SMILES notation for S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol?
The canonical SMILES for S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol is CC(C)(C)SN.Oc1cc(Cl)c(Cl)c(F)c1CC1CCNCC1.
What is the InChIKey of S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol?
The InChIKey is VPEMFFOKGKYYKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2FNO.C4H11NS/c13-9-6-10(17)8(12(15)11(9)14)5-7-1-3-16-4-2-7;1-4(2,3)6-5/h6-7,16-17H,1-5H2;5H2,1-3H3.
What are the key properties of S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol?
S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol has a molecular weight of 383.36 g/mol, XLogP of 4.77, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol is sourced from PubChem (CID 156723253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).