C16H25Cl2FN2OS — CID 156723253
S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol (PubChem CID 156723253) has the molecular formula C16H25Cl2FN2OS and a molecular weight of 383.36 g/mol. Its IUPAC name is S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol.
| Compound Name | S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol |
|---|---|
| PubChem CID | 156723253 |
| Molecular Formula | C16H25Cl2FN2OS |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | S-tert-butylthiohydroxylamine;4,5-dichloro-3-fluoro-2-(piperidin-4-ylmethyl)phenol |
| SMILES | CC(C)(C)SN.Oc1cc(Cl)c(Cl)c(F)c1CC1CCNCC1 |
| InChI | InChI=1S/C12H14Cl2FNO.C4H11NS/c13-9-6-10(17)8(12(15)11(9)14)5-7-1-3-16-4-2-7;1-4(2,3)6-5/h6-7,16-17H,1-5H2;5H2,1-3H3 |
| InChIKey | VPEMFFOKGKYYKB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|