C19H30Cl2N2OS — CID 156723049
S-tert-butylthiohydroxylamine;4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine (PubChem CID 156723049) has the molecular formula C19H30Cl2N2OS and a molecular weight of 405.44 g/mol. Its IUPAC name is S-tert-butylthiohydroxylamine;4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine.
| Compound Name | S-tert-butylthiohydroxylamine;4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 156723049 |
| Molecular Formula | C19H30Cl2N2OS |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | S-tert-butylthiohydroxylamine;4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1CC1CCNCC1.CC(C)(C)SN |
| InChI | InChI=1S/C15H19Cl2NO.C4H11NS/c1-2-7-19-15-10-14(17)13(16)9-12(15)8-11-3-5-18-6-4-11;1-4(2,3)6-5/h2,9-11,18H,1,3-8H2;5H2,1-3H3 |
| InChIKey | MOMWVLDDMWDNQS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|