C24H34Cl2N4OS — CID 156723155
S-tert-butylthiohydroxylamine;6-[4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidin-1-yl]pyridin-3-amine (PubChem CID 156723155) has the molecular formula C24H34Cl2N4OS and a molecular weight of 497.54 g/mol. Its IUPAC name is S-tert-butylthiohydroxylamine;6-[4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidin-1-yl]pyridin-3-amine.
| Compound Name | S-tert-butylthiohydroxylamine;6-[4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 156723155 |
| Molecular Formula | C24H34Cl2N4OS |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | S-tert-butylthiohydroxylamine;6-[4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidin-1-yl]pyridin-3-amine |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1CC1CCN(c2ccc(N)cn2)CC1.CC(C)(C)SN |
| InChI | InChI=1S/C20H23Cl2N3O.C4H11NS/c1-2-9-26-19-12-18(22)17(21)11-15(19)10-14-5-7-25(8-6-14)20-4-3-16(23)13-24-20;1-4(2,3)6-5/h2-4,11-14H,1,5-10,23H2;5H2,1-3H3 |
| InChIKey | UFSNUJKISCXVOI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|