C19H30Cl2N2O2S — CID 156723221
4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide (PubChem CID 156723221) has the molecular formula C19H30Cl2N2O2S and a molecular weight of 421.43 g/mol. Its IUPAC name is 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide.
| Compound Name | 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 156723221 |
| Molecular Formula | C19H30Cl2N2O2S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1CC1CCNCC1.CC(C)(C)S(N)=O |
| InChI | InChI=1S/C15H19Cl2NO.C4H11NOS/c1-2-7-19-15-10-14(17)13(16)9-12(15)8-11-3-5-18-6-4-11;1-4(2,3)7(5)6/h2,9-11,18H,1,3-8H2;5H2,1-3H3 |
| InChIKey | BZAIHTQYXZQGSV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|