About 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide
4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide (PubChem CID 156723221) has the molecular formula C19H30Cl2N2O2S
and a molecular weight of 421.43 g/mol. Its IUPAC name is 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide |
| PubChem CID | 156723221 |
| Molecular Formula | C19H30Cl2N2O2S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1CC1CCNCC1.CC(C)(C)S(N)=O |
| InChI | InChI=1S/C15H19Cl2NO.C4H11NOS/c1-2-7-19-15-10-14(17)13(16)9-12(15)8-11-3-5-18-6-4-11;1-4(2,3)7(5)6/h2,9-11,18H,1,3-8H2;5H2,1-3H3 |
| InChIKey | BZAIHTQYXZQGSV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide?
The IUPAC name of 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide (CID 156723221) is 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide.
What is the SMILES notation for 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide?
The canonical SMILES for 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide is C=CCOc1cc(Cl)c(Cl)cc1CC1CCNCC1.CC(C)(C)S(N)=O.
What is the InChIKey of 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide?
The InChIKey is BZAIHTQYXZQGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2NO.C4H11NOS/c1-2-7-19-15-10-14(17)13(16)9-12(15)8-11-3-5-18-6-4-11;1-4(2,3)7(5)6/h2,9-11,18H,1,3-8H2;5H2,1-3H3.
What are the key properties of 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide?
4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide has a molecular weight of 421.43 g/mol, XLogP of 4.51, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-dichloro-2-prop-2-enoxyphenyl)methyl]piperidine;2-methylpropane-2-sulfinamide is sourced from PubChem (CID 156723221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).