C22H32Cl2N2O4S — CID 167323241
(4R)-4-(4,5-dichloro-2-prop-2-enoxyphenyl)-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-2-methylbutane-2-sulfinamide (PubChem CID 167323241) has the molecular formula C22H32Cl2N2O4S and a molecular weight of 491.48 g/mol. Its IUPAC name is (4R)-4-(4,5-dichloro-2-prop-2-enoxyphenyl)-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-2-methylbutane-2-sulfinamide.
| Compound Name | (4R)-4-(4,5-dichloro-2-prop-2-enoxyphenyl)-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-2-methylbutane-2-sulfinamide |
|---|---|
| PubChem CID | 167323241 |
| Molecular Formula | C22H32Cl2N2O4S |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (4R)-4-(4,5-dichloro-2-prop-2-enoxyphenyl)-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-2-methylbutane-2-sulfinamide |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1[C@H](CC(C)(C)S(N)=O)C1CCN(C(=O)[C@H](C)O)CC1 |
| InChI | InChI=1S/C22H32Cl2N2O4S/c1-5-10-30-20-12-19(24)18(23)11-16(20)17(13-22(3,4)31(25)29)15-6-8-26(9-7-15)21(28)14(2)27/h5,11-12,14-15,17,27H,1,6-10,13,25H2,2-4H3/t14-,17+,31?/m0/s1 |
| InChIKey | JFNPEQBCDWBEMD-ZCEJCWSLSA-N |
| XLogP | 4.05 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|