About 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide
3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide (PubChem CID 156723728) has the molecular formula C18H26Cl2N2O4
and a molecular weight of 405.32 g/mol. Its IUPAC name is 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide.
Molecular Properties
| Compound Name | 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide |
| PubChem CID | 156723728 |
| Molecular Formula | C18H26Cl2N2O4 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide |
| SMILES | CCC(O)C(=O)N(C)CC(=O)N1CCCCC1.Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H22N2O3.C6H4Cl2O/c1-3-10(15)12(17)13(2)9-11(16)14-7-5-4-6-8-14;7-5-2-1-4(9)3-6(5)8/h10,15H,3-9H2,1-2H3;1-3,9H |
| InChIKey | YINMLIDZTOKHPB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide?
The IUPAC name of 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide (CID 156723728) is 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide.
What is the SMILES notation for 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide?
The canonical SMILES for 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide is CCC(O)C(=O)N(C)CC(=O)N1CCCCC1.Oc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide?
The InChIKey is YINMLIDZTOKHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3.C6H4Cl2O/c1-3-10(15)12(17)13(2)9-11(16)14-7-5-4-6-8-14;7-5-2-1-4(9)3-6(5)8/h10,15H,3-9H2,1-2H3;1-3,9H.
What are the key properties of 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide?
3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide has a molecular weight of 405.32 g/mol, XLogP of 2.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichlorophenol;2-hydroxy-N-methyl-N-(2-oxo-2-piperidin-1-ylethyl)butanamide is sourced from PubChem (CID 156723728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).