C26H27NO4 — CID 156725376
acetic acid;[3-[3-[1-(2-methylphenoxy)ethyl]-1-benzofuran-5-yl]phenyl]methanamine (PubChem CID 156725376) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is acetic acid;[3-[3-[1-(2-methylphenoxy)ethyl]-1-benzofuran-5-yl]phenyl]methanamine.
| Compound Name | acetic acid;[3-[3-[1-(2-methylphenoxy)ethyl]-1-benzofuran-5-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 156725376 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | acetic acid;[3-[3-[1-(2-methylphenoxy)ethyl]-1-benzofuran-5-yl]phenyl]methanamine |
| SMILES | CC(=O)O.Cc1ccccc1OC(C)c1coc2ccc(-c3cccc(CN)c3)cc12 |
| InChI | InChI=1S/C24H23NO2.C2H4O2/c1-16-6-3-4-9-23(16)27-17(2)22-15-26-24-11-10-20(13-21(22)24)19-8-5-7-18(12-19)14-25;1-2(3)4/h3-13,15,17H,14,25H2,1-2H3;1H3,(H,3,4) |
| InChIKey | JUQVSKYHARACBK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |