C18H15Cl2N4O2S+ — CID 156726873
N-[4-(aziridin-2-yl)-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazol-4-ium-5-yl]-4-chlorobenzamide (PubChem CID 156726873) has the molecular formula C18H15Cl2N4O2S+ and a molecular weight of 422.32 g/mol. Its IUPAC name is N-[4-(aziridin-2-yl)-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazol-4-ium-5-yl]-4-chlorobenzamide.
| Compound Name | N-[4-(aziridin-2-yl)-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazol-4-ium-5-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 156726873 |
| Molecular Formula | C18H15Cl2N4O2S+ |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | N-[4-(aziridin-2-yl)-2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazol-4-ium-5-yl]-4-chlorobenzamide |
| SMILES | O=C(Nc1sn(Cc2ccc(Cl)cc2)c(=O)[n+]1C1CN1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N4O2S/c19-13-5-1-11(2-6-13)10-23-18(26)24(15-9-21-15)17(27-23)22-16(25)12-3-7-14(20)8-4-12/h1-8,15,21H,9-10H2/p+1 |
| InChIKey | BAJNLAOQNKTXPW-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|