About 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane
3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane (PubChem CID 156728784) has the molecular formula C26H33N3O4
and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane.
Molecular Properties
| Compound Name | 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane |
| PubChem CID | 156728784 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane |
| SMILES | CCC.Cc1cccc(C)c1-c1cncc(CCC(=O)O)c1.NC(=O)Cn1ccccc1=O |
| InChI | InChI=1S/C16H17NO2.C7H8N2O2.C3H8/c1-11-4-3-5-12(2)16(11)14-8-13(9-17-10-14)6-7-15(18)19;8-6(10)5-9-4-2-1-3-7(9)11;1-3-2/h3-5,8-10H,6-7H2,1-2H3,(H,18,19);1-4H,5H2,(H2,8,10);3H2,1-2H3 |
| InChIKey | FHKYACMYDYPORE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane?
The IUPAC name of 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane (CID 156728784) is 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane.
What is the SMILES notation for 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane?
The canonical SMILES for 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane is CCC.Cc1cccc(C)c1-c1cncc(CCC(=O)O)c1.NC(=O)Cn1ccccc1=O.
What is the InChIKey of 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane?
The InChIKey is FHKYACMYDYPORE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2.C7H8N2O2.C3H8/c1-11-4-3-5-12(2)16(11)14-8-13(9-17-10-14)6-7-15(18)19;8-6(10)5-9-4-2-1-3-7(9)11;1-3-2/h3-5,8-10H,6-7H2,1-2H3,(H,18,19);1-4H,5H2,(H2,8,10);3H2,1-2H3.
What are the key properties of 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane?
3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane has a molecular weight of 451.57 g/mol, XLogP of 4.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid;2-(2-oxo-1-pyridinyl)acetamide;propane is sourced from PubChem (CID 156728784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).