C18H25ClN4O — CID 156730676
6-chloro-7-piperidin-4-ylquinazolin-2-amine;3-methyloxolane (PubChem CID 156730676) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 6-chloro-7-piperidin-4-ylquinazolin-2-amine;3-methyloxolane.
| Compound Name | 6-chloro-7-piperidin-4-ylquinazolin-2-amine;3-methyloxolane |
|---|---|
| PubChem CID | 156730676 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 6-chloro-7-piperidin-4-ylquinazolin-2-amine;3-methyloxolane |
| SMILES | CC1CCOC1.Nc1ncc2cc(Cl)c(C3CCNCC3)cc2n1 |
| InChI | InChI=1S/C13H15ClN4.C5H10O/c14-11-5-9-7-17-13(15)18-12(9)6-10(11)8-1-3-16-4-2-8;1-5-2-3-6-4-5/h5-8,16H,1-4H2,(H2,15,17,18);5H,2-4H2,1H3 |
| InChIKey | KSNHSYWZFFSOOZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |