C18H23Cl2N3O2 — CID 156730887
2,6-dichloro-7-(1-methylpiperidin-4-yl)quinazoline;oxolan-3-ol (PubChem CID 156730887) has the molecular formula C18H23Cl2N3O2 and a molecular weight of 384.31 g/mol. Its IUPAC name is 2,6-dichloro-7-(1-methylpiperidin-4-yl)quinazoline;oxolan-3-ol.
| Compound Name | 2,6-dichloro-7-(1-methylpiperidin-4-yl)quinazoline;oxolan-3-ol |
|---|---|
| PubChem CID | 156730887 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2,6-dichloro-7-(1-methylpiperidin-4-yl)quinazoline;oxolan-3-ol |
| SMILES | CN1CCC(c2cc3nc(Cl)ncc3cc2Cl)CC1.OC1CCOC1 |
| InChI | InChI=1S/C14H15Cl2N3.C4H8O2/c1-19-4-2-9(3-5-19)11-7-13-10(6-12(11)15)8-17-14(16)18-13;5-4-1-2-6-3-4/h6-9H,2-5H2,1H3;4-5H,1-3H2 |
| InChIKey | GHVFHWUMTVJPQM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |