C36H42ClN3O5 — CID 156733041
(2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 156733041) has the molecular formula C36H42ClN3O5 and a molecular weight of 632.20 g/mol. Its IUPAC name is (2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 156733041 |
| Molecular Formula | C36H42ClN3O5 |
| Molecular Weight | 632.20 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | (2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OCCCN2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C36H42ClN3O5/c1-36(2,3)45-35(43)39-31(34(41)42)22-24-7-12-29(13-8-24)44-21-5-18-40-19-15-25(16-20-40)32-30-14-11-28(37)23-27(30)10-9-26-6-4-17-38-33(26)32/h4,6-8,11-14,17,23,31H,5,9-10,15-16,18-22H2,1-3H3,(H,39,43)(H,41,42)/t31-/m0/s1 |
| InChIKey | VJPZSIGKHBIUSD-HKBQPEDESA-N |
| XLogP | 6.72 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.20 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|