C14H23N3O3 — CID 156733131
[(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate (PubChem CID 156733131) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is [(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate.
| Compound Name | [(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate |
|---|---|
| PubChem CID | 156733131 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | [(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate |
| SMILES | C/C=C\C/C(=C\C=N\COC(N)=O)C(=O)NCC(C)C |
| InChI | InChI=1S/C14H23N3O3/c1-4-5-6-12(13(18)17-9-11(2)3)7-8-16-10-20-14(15)19/h4-5,7-8,11H,6,9-10H2,1-3H3,(H2,15,19)(H,17,18)/b5-4-,12-7+,16-8+ |
| InChIKey | DFJMZLKUBDDNDL-KJWBULNLSA-N |
| XLogP | 1.77 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|