C22H17N3O — CID 156734063
5-[(3-methoxyphenyl)methyl]-3-(2-pyridin-2-ylethynyl)-2H-indazole (PubChem CID 156734063) has the molecular formula C22H17N3O and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)methyl]-3-(2-pyridin-2-ylethynyl)-2H-indazole.
| Compound Name | 5-[(3-methoxyphenyl)methyl]-3-(2-pyridin-2-ylethynyl)-2H-indazole |
|---|---|
| PubChem CID | 156734063 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 5-[(3-methoxyphenyl)methyl]-3-(2-pyridin-2-ylethynyl)-2H-indazole |
| SMILES | COc1cccc(Cc2ccc3n[nH]c(C#Cc4ccccn4)c3c2)c1 |
| InChI | InChI=1S/C22H17N3O/c1-26-19-7-4-5-16(14-19)13-17-8-10-21-20(15-17)22(25-24-21)11-9-18-6-2-3-12-23-18/h2-8,10,12,14-15H,13H2,1H3,(H,24,25) |
| InChIKey | GCTXQHQCWQNJDO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|