C21H12F3N3 — CID 156734132
3-(2-pyridin-2-ylethynyl)-5-[(3,4,5-trifluorophenyl)methyl]-2H-indazole (PubChem CID 156734132) has the molecular formula C21H12F3N3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 3-(2-pyridin-2-ylethynyl)-5-[(3,4,5-trifluorophenyl)methyl]-2H-indazole.
| Compound Name | 3-(2-pyridin-2-ylethynyl)-5-[(3,4,5-trifluorophenyl)methyl]-2H-indazole |
|---|---|
| PubChem CID | 156734132 |
| Molecular Formula | C21H12F3N3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 3-(2-pyridin-2-ylethynyl)-5-[(3,4,5-trifluorophenyl)methyl]-2H-indazole |
| SMILES | Fc1cc(Cc2ccc3n[nH]c(C#Cc4ccccn4)c3c2)cc(F)c1F |
| InChI | InChI=1S/C21H12F3N3/c22-17-11-14(12-18(23)21(17)24)9-13-4-6-19-16(10-13)20(27-26-19)7-5-15-3-1-2-8-25-15/h1-4,6,8,10-12H,9H2,(H,26,27) |
| InChIKey | WXTFKGBIFVHARG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|