C15H9F3N2O — CID 84595317
2,4,5-trifluoro-N-(3-pyridin-2-ylprop-2-ynyl)benzamide (PubChem CID 84595317) has the molecular formula C15H9F3N2O and a molecular weight of 290.24 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-(3-pyridin-2-ylprop-2-ynyl)benzamide.
| Compound Name | 2,4,5-trifluoro-N-(3-pyridin-2-ylprop-2-ynyl)benzamide |
|---|---|
| PubChem CID | 84595317 |
| Molecular Formula | C15H9F3N2O |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2,4,5-trifluoro-N-(3-pyridin-2-ylprop-2-ynyl)benzamide |
| SMILES | O=C(NCC#Cc1ccccn1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H9F3N2O/c16-12-9-14(18)13(17)8-11(12)15(21)20-7-3-5-10-4-1-2-6-19-10/h1-2,4,6,8-9H,7H2,(H,20,21) |
| InChIKey | XNUNPTWRJFZWPI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|