C8H5F3NO3S- — CID 174758593
[(2,4,5-trifluorobenzoyl)amino]methanesulfinate (PubChem CID 174758593) has the molecular formula C8H5F3NO3S- and a molecular weight of 252.19 g/mol. Its IUPAC name is [(2,4,5-trifluorobenzoyl)amino]methanesulfinate.
| Compound Name | [(2,4,5-trifluorobenzoyl)amino]methanesulfinate |
|---|---|
| PubChem CID | 174758593 |
| Molecular Formula | C8H5F3NO3S- |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | [(2,4,5-trifluorobenzoyl)amino]methanesulfinate |
| SMILES | O=C(NCS(=O)[O-])c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C8H6F3NO3S/c9-5-2-7(11)6(10)1-4(5)8(13)12-3-16(14)15/h1-2H,3H2,(H,12,13)(H,14,15)/p-1 |
| InChIKey | XBRHEPJXSUYXLF-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|