About N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine
N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine (PubChem CID 156734075) has the molecular formula C23H19F2N3
and a molecular weight of 375.42 g/mol. Its IUPAC name is N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine.
Molecular Properties
| Compound Name | N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine |
| PubChem CID | 156734075 |
| Molecular Formula | C23H19F2N3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine |
| SMILES | C[C@@H](Nc1ccc2[nH]nc(/C=C/c3ccccc3)c2c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H19F2N3/c1-15(17-11-18(24)13-19(25)12-17)26-20-8-10-23-21(14-20)22(27-28-23)9-7-16-5-3-2-4-6-16/h2-15,26H,1H3,(H,27,28)/b9-7+/t15-/m1/s1 |
| InChIKey | DDBGMPFBLOFBCR-LOWQCSRCSA-N |
| XLogP | 6.18 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine?
The IUPAC name of N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine (CID 156734075) is N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine.
What is the SMILES notation for N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine?
The canonical SMILES for N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine is C[C@@H](Nc1ccc2[nH]nc(/C=C/c3ccccc3)c2c1)c1cc(F)cc(F)c1.
What is the InChIKey of N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine?
The InChIKey is DDBGMPFBLOFBCR-LOWQCSRCSA-N. The full InChI is InChI=1S/C23H19F2N3/c1-15(17-11-18(24)13-19(25)12-17)26-20-8-10-23-21(14-20)22(27-28-23)9-7-16-5-3-2-4-6-16/h2-15,26H,1H3,(H,27,28)/b9-7+/t15-/m1/s1.
What are the key properties of N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine?
N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine has a molecular weight of 375.42 g/mol, XLogP of 6.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(3,5-difluorophenyl)ethyl]-3-[(E)-2-phenylethenyl]-1H-indazol-5-amine is sourced from PubChem (CID 156734075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).