C23H27BrN2O3 — CID 156734448
benzyl 3-[[4-(4-bromophenyl)oxan-4-yl]-methylamino]azetidine-1-carboxylate (PubChem CID 156734448) has the molecular formula C23H27BrN2O3 and a molecular weight of 459.38 g/mol. Its IUPAC name is benzyl 3-[[4-(4-bromophenyl)oxan-4-yl]-methylamino]azetidine-1-carboxylate.
| Compound Name | benzyl 3-[[4-(4-bromophenyl)oxan-4-yl]-methylamino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 156734448 |
| Molecular Formula | C23H27BrN2O3 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | benzyl 3-[[4-(4-bromophenyl)oxan-4-yl]-methylamino]azetidine-1-carboxylate |
| SMILES | CN(C1CN(C(=O)OCc2ccccc2)C1)C1(c2ccc(Br)cc2)CCOCC1 |
| InChI | InChI=1S/C23H27BrN2O3/c1-25(23(11-13-28-14-12-23)19-7-9-20(24)10-8-19)21-15-26(16-21)22(27)29-17-18-5-3-2-4-6-18/h2-10,21H,11-17H2,1H3 |
| InChIKey | FQMDGJDZIBPHKW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |