C19H17F3N4O — CID 156735397
(3E)-3-(aminomethylidene)-4-[[2-[[4-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]imino]piperidin-2-one (PubChem CID 156735397) has the molecular formula C19H17F3N4O and a molecular weight of 374.37 g/mol. Its IUPAC name is (3E)-3-(aminomethylidene)-4-[[2-[[4-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]imino]piperidin-2-one.
| Compound Name | (3E)-3-(aminomethylidene)-4-[[2-[[4-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]imino]piperidin-2-one |
|---|---|
| PubChem CID | 156735397 |
| Molecular Formula | C19H17F3N4O |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (3E)-3-(aminomethylidene)-4-[[2-[[4-(trifluoromethyl)phenyl]methyl]-4-pyridinyl]imino]piperidin-2-one |
| SMILES | N/C=C1/C(=O)NCC/C1=N\c1ccnc(Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H17F3N4O/c20-19(21,22)13-3-1-12(2-4-13)9-15-10-14(5-7-24-15)26-17-6-8-25-18(27)16(17)11-23/h1-5,7,10-11H,6,8-9,23H2,(H,25,27)/b16-11+,26-17+ |
| InChIKey | GUGLMAJLCZLIIU-YVYJZWDNSA-N |
| XLogP | 3.13 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|