C31H33F3N4O3 — CID 156736222
N-(3-aminopropyl)-2-[4-[2-cyano-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-5-(2-ethoxyphenyl)benzamide (PubChem CID 156736222) has the molecular formula C31H33F3N4O3 and a molecular weight of 566.62 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[4-[2-cyano-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-5-(2-ethoxyphenyl)benzamide.
| Compound Name | N-(3-aminopropyl)-2-[4-[2-cyano-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-5-(2-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 156736222 |
| Molecular Formula | C31H33F3N4O3 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | N-(3-aminopropyl)-2-[4-[2-cyano-4-(trifluoromethyl)phenoxy]piperidin-1-yl]-5-(2-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccccc1-c1ccc(N2CCC(Oc3ccc(C(F)(F)F)cc3C#N)CC2)c(C(=O)NCCCN)c1 |
| InChI | InChI=1S/C31H33F3N4O3/c1-2-40-29-7-4-3-6-25(29)21-8-10-27(26(19-21)30(39)37-15-5-14-35)38-16-12-24(13-17-38)41-28-11-9-23(31(32,33)34)18-22(28)20-36/h3-4,6-11,18-19,24H,2,5,12-17,35H2,1H3,(H,37,39) |
| InChIKey | IAJNHVJVIWMDFG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|