C11H24N2 — CID 156736334
1,8-dimethyl-1,8-diazaspiro[3.5]nonane;ethane (PubChem CID 156736334) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1,8-dimethyl-1,8-diazaspiro[3.5]nonane;ethane.
| Compound Name | 1,8-dimethyl-1,8-diazaspiro[3.5]nonane;ethane |
|---|---|
| PubChem CID | 156736334 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1,8-dimethyl-1,8-diazaspiro[3.5]nonane;ethane |
| SMILES | CC.CN1CCCC2(CCN2C)C1 |
| InChI | InChI=1S/C9H18N2.C2H6/c1-10-6-3-4-9(8-10)5-7-11(9)2;1-2/h3-8H2,1-2H3;1-2H3 |
| InChIKey | KOALUUYBUKEATK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |