C13H28N2OS — CID 143985227
4,9-dimethyl-1-thia-4,9-diazaspiro[4.5]decan-2-one;ethane (PubChem CID 143985227) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is 4,9-dimethyl-1-thia-4,9-diazaspiro[4.5]decan-2-one;ethane.
| Compound Name | 4,9-dimethyl-1-thia-4,9-diazaspiro[4.5]decan-2-one;ethane |
|---|---|
| PubChem CID | 143985227 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4,9-dimethyl-1-thia-4,9-diazaspiro[4.5]decan-2-one;ethane |
| SMILES | CC.CC.CN1CCCC2(C1)SC(=O)CN2C |
| InChI | InChI=1S/C9H16N2OS.2C2H6/c1-10-5-3-4-9(7-10)11(2)6-8(12)13-9;2*1-2/h3-7H2,1-2H3;2*1-2H3 |
| InChIKey | SCKMWZADIVLDLG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|