C9H18N2O2 — CID 156736454
1,1,3-trimethyl-3-(3-methyl-1-oxobutan-2-yl)urea (PubChem CID 156736454) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-(3-methyl-1-oxobutan-2-yl)urea.
| Compound Name | 1,1,3-trimethyl-3-(3-methyl-1-oxobutan-2-yl)urea |
|---|---|
| PubChem CID | 156736454 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1,1,3-trimethyl-3-(3-methyl-1-oxobutan-2-yl)urea |
| SMILES | CC(C)C(C=O)N(C)C(=O)N(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-7(2)8(6-12)11(5)9(13)10(3)4/h6-8H,1-5H3 |
| InChIKey | DCAGHJXTBTZGCN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|