C32H64N5O11P — CID 156738180
N-[2-[[2-[2-[2-[2-[butyl(ethoxy)phosphoryl]oxyethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]-2-formamidoacetamide;ethane;1-[(3S)-3-methoxypyrrolidin-1-yl]hexan-1-one (PubChem CID 156738180) has the molecular formula C32H64N5O11P and a molecular weight of 725.86 g/mol. Its IUPAC name is N-[2-[[2-[2-[2-[2-[butyl(ethoxy)phosphoryl]oxyethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]-2-formamidoacetamide;ethane;1-[(3S)-3-methoxypyrrolidin-1-yl]hexan-1-one.
| Compound Name | N-[2-[[2-[2-[2-[2-[butyl(ethoxy)phosphoryl]oxyethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]-2-formamidoacetamide;ethane;1-[(3S)-3-methoxypyrrolidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 156738180 |
| Molecular Formula | C32H64N5O11P |
| Molecular Weight | 725.86 g/mol |
| Exact Mass | 725.43 |
| IUPAC Name | N-[2-[[2-[2-[2-[2-[butyl(ethoxy)phosphoryl]oxyethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]-2-oxoethyl]-2-formamidoacetamide;ethane;1-[(3S)-3-methoxypyrrolidin-1-yl]hexan-1-one |
| SMILES | CC.CCCCCC(=O)N1CC[C@H](OC)C1.CCCCP(=O)(OCC)OCCOCCOCCNC(=O)CNC(=O)CNC(=O)CNC=O |
| InChI | InChI=1S/C19H37N4O9P.C11H21NO2.C2H6/c1-3-5-12-33(28,31-4-2)32-11-10-30-9-8-29-7-6-21-18(26)14-23-19(27)15-22-17(25)13-20-16-24;1-3-4-5-6-11(13)12-8-7-10(9-12)14-2;1-2/h16H,3-15H2,1-2H3,(H,20,24)(H,21,26)(H,22,25)(H,23,27);10H,3-9H2,1-2H3;1-2H3/t;10-;/m.0./s1 |
| InChIKey | CRAJVCVWKQWDFA-RBPNCNDUSA-N |
| XLogP | 2.00 |
| TPSA | 199.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.86 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|