C16H23N5O — CID 156739122
1-[5-[[5-ethenyl-6-(methylamino)pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 156739122) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[5-[[5-ethenyl-6-(methylamino)pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[5-[[5-ethenyl-6-(methylamino)pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156739122 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-[5-[[5-ethenyl-6-(methylamino)pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Nc2ncnc(NC)c2C=C)CCC1C |
| InChI | InChI=1S/C16H23N5O/c1-5-13-15(17-4)18-10-19-16(13)20-12-8-7-11(3)21(9-12)14(22)6-2/h5-6,10-12H,1-2,7-9H2,3-4H3,(H2,17,18,19,20) |
| InChIKey | CSKJPNBZHCWZDG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|