C20H27N3O2S2 — CID 156739155
1-N-[2-(azepan-1-yl)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfinamide (PubChem CID 156739155) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 1-N-[2-(azepan-1-yl)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfinamide.
| Compound Name | 1-N-[2-(azepan-1-yl)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfinamide |
|---|---|
| PubChem CID | 156739155 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-N-[2-(azepan-1-yl)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfinamide |
| SMILES | CN(C)S(=O)c1ccc(S(=O)Nc2ccccc2N2CCCCCC2)cc1 |
| InChI | InChI=1S/C20H27N3O2S2/c1-22(2)27(25)18-13-11-17(12-14-18)26(24)21-19-9-5-6-10-20(19)23-15-7-3-4-8-16-23/h5-6,9-14,21H,3-4,7-8,15-16H2,1-2H3 |
| InChIKey | OZEIRVQSLZKXCG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |