C17H23N3S3 — CID 163241638
N-[5-(dimethylaminosulfanyl)thiophen-2-yl]sulfanyl-2-piperidin-1-ylaniline (PubChem CID 163241638) has the molecular formula C17H23N3S3 and a molecular weight of 365.59 g/mol. Its IUPAC name is N-[5-(dimethylaminosulfanyl)thiophen-2-yl]sulfanyl-2-piperidin-1-ylaniline.
| Compound Name | N-[5-(dimethylaminosulfanyl)thiophen-2-yl]sulfanyl-2-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 163241638 |
| Molecular Formula | C17H23N3S3 |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[5-(dimethylaminosulfanyl)thiophen-2-yl]sulfanyl-2-piperidin-1-ylaniline |
| SMILES | CN(C)Sc1ccc(SNc2ccccc2N2CCCCC2)s1 |
| InChI | InChI=1S/C17H23N3S3/c1-19(2)23-17-11-10-16(21-17)22-18-14-8-4-5-9-15(14)20-12-6-3-7-13-20/h4-5,8-11,18H,3,6-7,12-13H2,1-2H3 |
| InChIKey | PBCLABHEXNDYHD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|