C17H23N3O4S3 — CID 175714104
4-N,4-N-dimethyl-2-N-(2-piperidin-1-ylphenyl)thiophene-2,4-disulfonamide (PubChem CID 175714104) has the molecular formula C17H23N3O4S3 and a molecular weight of 429.59 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-N-(2-piperidin-1-ylphenyl)thiophene-2,4-disulfonamide.
| Compound Name | 4-N,4-N-dimethyl-2-N-(2-piperidin-1-ylphenyl)thiophene-2,4-disulfonamide |
|---|---|
| PubChem CID | 175714104 |
| Molecular Formula | C17H23N3O4S3 |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-N,4-N-dimethyl-2-N-(2-piperidin-1-ylphenyl)thiophene-2,4-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1csc(S(=O)(=O)Nc2ccccc2N2CCCCC2)c1 |
| InChI | InChI=1S/C17H23N3O4S3/c1-19(2)27(23,24)14-12-17(25-13-14)26(21,22)18-15-8-4-5-9-16(15)20-10-6-3-7-11-20/h4-5,8-9,12-13,18H,3,6-7,10-11H2,1-2H3 |
| InChIKey | OZPHATLAEKOOLH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |