C15H17FN2O2S2 — CID 113092648
N-(5-fluoro-2-piperidin-1-ylphenyl)thiophene-2-sulfonamide (PubChem CID 113092648) has the molecular formula C15H17FN2O2S2 and a molecular weight of 340.44 g/mol. Its IUPAC name is N-(5-fluoro-2-piperidin-1-ylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(5-fluoro-2-piperidin-1-ylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113092648 |
| Molecular Formula | C15H17FN2O2S2 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-(5-fluoro-2-piperidin-1-ylphenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)ccc1N1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C15H17FN2O2S2/c16-12-6-7-14(18-8-2-1-3-9-18)13(11-12)17-22(19,20)15-5-4-10-21-15/h4-7,10-11,17H,1-3,8-9H2 |
| InChIKey | JEQGISGLRQPCQC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |