C19H23N3O3S3 — CID 143365455
N-(4-methyl-8-piperidin-1-yl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide (PubChem CID 143365455) has the molecular formula C19H23N3O3S3 and a molecular weight of 437.61 g/mol. Its IUPAC name is N-(4-methyl-8-piperidin-1-yl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide.
| Compound Name | N-(4-methyl-8-piperidin-1-yl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 143365455 |
| Molecular Formula | C19H23N3O3S3 |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-(4-methyl-8-piperidin-1-yl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide |
| SMILES | CC1Cc2cc(NS(=O)(=O)c3cccs3)c(N3CCCCC3)cc2NC(=S)O1 |
| InChI | InChI=1S/C19H23N3O3S3/c1-13-10-14-11-16(21-28(23,24)18-6-5-9-27-18)17(22-7-3-2-4-8-22)12-15(14)20-19(26)25-13/h5-6,9,11-13,21H,2-4,7-8,10H2,1H3,(H,20,26) |
| InChIKey | PIGPDASEWASLHI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|