C15H16N2O3S3 — CID 11999918
N-(4,9-dimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide (PubChem CID 11999918) has the molecular formula C15H16N2O3S3 and a molecular weight of 368.51 g/mol. Its IUPAC name is N-(4,9-dimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide.
| Compound Name | N-(4,9-dimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11999918 |
| Molecular Formula | C15H16N2O3S3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-(4,9-dimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cccs2)cc2c1NC(=S)OC(C)C2 |
| InChI | InChI=1S/C15H16N2O3S3/c1-9-6-12(17-23(18,19)13-4-3-5-22-13)8-11-7-10(2)20-15(21)16-14(9)11/h3-6,8,10,17H,7H2,1-2H3,(H,16,21) |
| InChIKey | DOUYHQLBEJDMRD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|