C14H15N3O3S2 — CID 11999792
N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-1H-pyrrole-2-sulfonamide (PubChem CID 11999792) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-1H-pyrrole-2-sulfonamide.
| Compound Name | N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-1H-pyrrole-2-sulfonamide |
|---|---|
| PubChem CID | 11999792 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-1H-pyrrole-2-sulfonamide |
| SMILES | CC1Cc2cc(NS(=O)(=O)c3ccc[nH]3)ccc2NC(=S)O1 |
| InChI | InChI=1S/C14H15N3O3S2/c1-9-7-10-8-11(4-5-12(10)16-14(21)20-9)17-22(18,19)13-3-2-6-15-13/h2-6,8-9,15,17H,7H2,1H3,(H,16,21) |
| InChIKey | XNDAWVJGWLJYHD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|