C21H19N3O5S3 — CID 143365343
N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-2-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 143365343) has the molecular formula C21H19N3O5S3 and a molecular weight of 489.60 g/mol. Its IUPAC name is N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-2-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-2-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 143365343 |
| Molecular Formula | C21H19N3O5S3 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)-2-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CC1Cc2cc(N(Cc3cccs3)S(=O)(=O)c3ccccc3[N+](=O)[O-])ccc2NC(=S)O1 |
| InChI | InChI=1S/C21H19N3O5S3/c1-14-11-15-12-16(8-9-18(15)22-21(30)29-14)23(13-17-5-4-10-31-17)32(27,28)20-7-3-2-6-19(20)24(25)26/h2-10,12,14H,11,13H2,1H3,(H,22,30) |
| InChIKey | KCJJHEPCUFPNEL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|