C15H17N3O5S2 — CID 2424003
2-[ethyl-(2-nitrophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 2424003) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[ethyl-(2-nitrophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[ethyl-(2-nitrophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 2424003 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-[ethyl-(2-nitrophenyl)sulfonylamino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCN(CC(=O)NCc1cccs1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O5S2/c1-2-17(11-15(19)16-10-12-6-5-9-24-12)25(22,23)14-8-4-3-7-13(14)18(20)21/h3-9H,2,10-11H2,1H3,(H,16,19) |
| InChIKey | ILEAPIUBXDPEJV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|